| Status: | none |
|---|---|
| IUPAC: | 2-(1-naphthyl)acetamide |
| CAS: | 1-naphthaleneacetamide |
| Reg. No.: | 86-86-2 |
| Formula: | C12H11NO |
| Activity: | plant growth regulators (auxins) |
| Notes: | There is no ISO common name for this substance; the names “naphthaleneacetamide” and “NAAm” have been used in the literature but they have no official status. |
| Structure: | ![]() |
| Pronunciation: | nǎf-tha-lēn-a-sēt-a-mīd Guide to British pronunciation |
| InChIKey: | XFNJVKMNNVCYEK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H11NO/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H2,13,14) |
A data sheet from the Compendium of Pesticide Common Names