| Status: | ISO 765 |
|---|---|
| IUPAC: | naphthalene |
| CAS: | naphthalene |
| Reg. No.: | 91-20-3 |
| Formula: | C10H8 |
| Activity: | insecticides (fumigant insecticides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | ![]() |
| Pronunciation: | nǎf-tha-lēn Guide to British pronunciation |
| InChI: | InChI=1/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H |
A data sheet from the Compendium of Pesticide Common Names