monochloroacetic acid


Status: ISO 765
IUPAC: chloroacetic acid
CAS: chloroacetic acid
Reg. No.: 79-11-8
Formula: C2H3ClO2
Activity: herbicides (halogenated aliphatic herbicides)
Notes: This substance is considered by the International Organization for Standardization not to require a common name; “chloroacetic acid” is given as an alternative.
The trivial name SMA is sometimes used for the sodium salt.
Structure: Structural formula of monochloroacetic acid
Pronunciation: mǒ-nō-klor-ō-a--tǐk ǎs-ǐd  Guide to British pronunciation
InChI: InChI=1/C2H3ClO2/c3-1-2(4)5/h1H2,(H,4,5)/f/h4H

A data sheet from the Compendium of Pesticide Common Names