| Status: | BSI |
|---|---|
| IUPAC: | 4,4′,6,6′-tetramethyl-3,3′-ethylenedi-1,3,5-thiadiazinane-2-thione |
| CAS: | 3,3′-(1,2-ethanediyl)bis[tetrahydro-4,6-dimethyl-2H-1,3,5-thiadiazine-2-thione] |
| Reg. No.: | 3773-49-7 |
| Formula: | C12H22N4S4 |
| Activity: | fungicides (cyclic dithiocarbamate fungicides) |
| Notes: | There is no ISO common name for this substance; the name “milneb” is approved by the British Standards Institution and the American National Standards Institute, and is also approved in China (代森环). The name “thiadiazine” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |  |
| Pronunciation: | mǐl-něb Guide to British pronunciation |
| InChIKey: | JZFICWYCTCCINF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H22N4S4/c1-7-13-9(3)19-11(17)15(7)5-6-16-8(2)14-10(4)20-12(16)18/h7-10,13-14H,5-6H2,1-4H3 |