| Status: | ISO 1750 (approved) |
|---|---|
| IUPAC: | m-tolyl methylcarbamate |
| CAS: | 3-methylphenyl methylcarbamate |
| Reg. No.: | 1129-41-5 |
| Formula: | C9H11NO2 |
| Activity: | acaricides (carbamate acaricides) insecticides (phenyl methylcarbamate insecticides) |
| Notes: | The name “métholcarb” is used in France, and the name “MTMC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |  |
| Pronunciation: | mē-tǒl-karb Guide to British pronunciation |
| InChI: | InChI=1/C9H11NO2/c1-7-4-3-5-8(6-7)12-9(11)10-2/h3-6H,1-2H3,(H,10,11)/f/h10H |