| Status: | BS 1831c |
|---|---|
| IUPAC: | 1-cyano-3-(methylmercurio)guanidine |
| CAS: | (cyanoguanidinato-κN′)methylmercury |
| Reg. No.: | 502-39-6 |
| Formula: | C3H6HgN4 |
| Activity: | fungicides (organomercury fungicides) |
| Notes: | This substance is considered by the British Standards Institution not to require a common name. |
| Structure: | ![]() |
| Pronunciation: | mē-thīl-mer-kūr-ē dī-sī-ǎn-dī-ām-īd Guide to British pronunciation |
| InChIKey: | JVJUWCMBRUMDDQ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C2H3N4.CH3.Hg/c3-1-6-2(4)5;;/h(H3-,4,5,6);1H3;/q-1;;+1 |
A data sheet from the Compendium of Pesticide Common Names