Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 3,5-dimethyl-4-(methylsulfanyl)phenyl methylcarbamate |
IUPAC name: | 3,5-dimethyl-4-(methylthio)phenyl methylcarbamate 1979 Rules: 4-(methylthio)-3,5-xylyl methylcarbamate |
CAS name: | 3,5-dimethyl-4-(methylthio)phenyl N-methylcarbamate |
CAS Reg. No.: | 2032-65-7 |
Formula: | C11H15NO2S |
Activity: | acaricides (phenyl carbamate) bird repellents insecticides (phenyl carbamate) molluscicides |
Notes: | The common name “mercaptodimethur” was also formerly approved by ISO for this substance, but was withdrawn in 2020. |
Structure: | |
Pronunciation: | mě-thī-ō-karb Guide to British pronunciation |
InChIKey: | YFBPRJGDJKVWAH-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H15NO2S/c1-7-5-9(14-11(13)12-3)6-8(2)10(7)15-4/h5-6H,1-4H3,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names