Status: | ISO 1750 (approved) |
---|---|
IUPAC PIN: | 2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione |
IUPAC name: | 2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione |
CAS name: | 2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione |
CAS Reg. No.: | 20354-26-1 |
Formula: | C9H6Cl2N2O3 |
Activity: | herbicides (unclassified) |
Notes: | The name “methazole” was formerly approved by the British Standards Institution and was adopted by ISO in 2020. |
Structure: | |
Pronunciation: | měth-a-zōl Guide to British pronunciation |
InChIKey: | LRUUNMYPIBZBQH-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H6Cl2N2O3/c1-12-8(14)13(16-9(12)15)5-2-3-6(10)7(11)4-5/h2-4H,1H3 |
A data sheet from the Compendium of Pesticide Common Names