| Status: |
BSI |
| IUPAC: |
2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione |
| CAS: |
2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione |
| Reg. No.: |
20354-26-1 |
| Formula: |
C9H6Cl2N2O3 |
| Activity: |
herbicides (oxadiazolone herbicides) |
| Notes: |
There is no ISO common name for this substance; the name “methazole” is approved by the British Standards Institution, the American National Standards Institute and the Weed Science Society of America, and is also approved in China (灭草唑). |
| Structure: |
 |
| Pronunciation: |
měth-a-zōl Guide to British pronunciation |
| InChIKey: |
LRUUNMYPIBZBQH-UHFFFAOYSA-N |
| InChI: |
InChI=1S/C9H6Cl2N2O3/c1-12-8(14)13(16-9(12)15)5-2-3-6(10)7(11)4-5/h2-4H,1H3 |