| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1-(1,3-benzothiazol-2-yl)-1,3-dimethylurea or 1-benzothiazol-2-yl-1,3-dimethylurea |
| CAS: | N-2-benzothiazolyl-N,N′-dimethylurea |
| Reg. No.: | 18691-97-9 |
| Formula: | C10H11N3OS |
| Activity: | algicides herbicides (benzothiazole herbicides; urea herbicides) |
| Notes: | The name “methibenzuron” is approved by the Weed Science Society of America. |
| Structure: | ![]() |
| Pronunciation: | měth-a-běnz-thī-ǎz-ūr-ǒn Guide to British pronunciation |
| InChI: | InChI=1/C10H11N3OS/c1-11-9(14)13(2)10-12-7-5-3-4-6-8(7)15-10/h3-6H,1-2H3,(H,11,14)/f/h11H |
A data sheet from the Compendium of Pesticide Common Names