Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | N-(1,3-benzothiazol-2-yl)-N,N′-dimethylurea |
IUPAC name: | 1-(1,3-benzothiazol-2-yl)-1,3-dimethylurea |
CAS name: | N-2-benzothiazolyl-N,N′-dimethylurea |
CAS Reg. No.: | 18691-97-9 |
Formula: | C10H11N3OS |
Activity: | algicides herbicides (urea) |
Notes: | The name “methibenzuron” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | měth-a-běnz-thī-ǎz-ūr-ǒn Guide to British pronunciation |
InChIKey: | RRVIAQKBTUQODI-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H11N3OS/c1-11-9(14)13(2)10-12-7-5-3-4-6-8(7)15-10/h3-6H,1-2H3,(H,11,14) |
A data sheet from the Compendium of Pesticide Common Names