Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | 2,4,6,8-tetramethyl-1,3,5,7-tetroxocane |
IUPAC name: | 2,4,6,8-tetramethyl-1,3,5,7-tetraoxocane or 2,4,6,8-tetramethyl-1,3,5,7-tetraoxacyclooctane |
CAS name: | 2,4,6,8-tetramethyl-1,3,5,7-tetroxocane |
CAS Reg. No.: | 108-62-3 |
Formula: | C8H16O4 |
Activity: | molluscicides |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The technical grade contains some higher oligomers in addition to the tetramer. |
Structure: | |
Pronunciation: | mě-tǎl-dǐ-hīd Guide to British pronunciation |
InChIKey: | GKKDCARASOJPNG-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H16O4/c1-5-9-6(2)11-8(4)12-7(3)10-5/h5-8H,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names