| Status: | ISO 765 |
|---|---|
| IUPAC: | r-2,c-4,c-6,c-8-tetramethyl-1,3,5,7-tetroxocane or 2,4,6,8-tetramethyl-1,3,5,7-tetraoxacyclooctane |
| CAS: | 2,4,6,8-tetramethyl-1,3,5,7-tetraoxacyclooctane |
| Reg. No.: | 108-62-3 |
| Formula: | C8H16O4 |
| Activity: | molluscicides |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The technical grade contains some higher oligomers in addition to the tetramer. |
| Structure: |  |
| Pronunciation: | mě-tǎl-dǐ-hīd Guide to British pronunciation |
| InChI: | InChI=1/C8H16O4/c1-5-9-6(2)11-8(4)12-7(3)10-5/h5-8H,1-4H3 |