| Status: | none |
|---|---|
| IUPAC: | tributyl phosphorotrithioite |
| CAS: | tributyl phosphorotrithioite |
| Reg. No.: | 150-50-5 |
| Formula: | C12H27PS3 |
| Activity: | plant growth regulators (defoliants) |
| Notes: | There is no ISO common name for this substance; the name “merphos” has been used in the literature but has no official status. |
| Structure: | ![]() |
| Pronunciation: | mer-fǒs Guide to British pronunciation |
| InChI: | InChI=1/C12H27PS3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h4-12H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names