| Status: | WSSA |
|---|---|
| IUPAC: | 4-chlorophenyl methylcarbamate |
| CAS: | 4-chlorophenyl N-methylcarbamate |
| Reg. No.: | 2620-53-3 |
| Formula: | C8H8ClNO2 |
| Activity: | herbicide safeners |
| Notes: | There is no ISO common name for this substance; the name “mephenate” is approved by the Weed Science Society of America. |
| Structure: | ![]() |
| Pronunciation: | mě-fěn-āt Guide to British pronunciation |
| InChIKey: | WMMQJAQJAPXWDO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H8ClNO2/c1-10-8(11)12-7-4-2-6(9)3-5-7/h2-5H,1H3,(H,10,11) |
A data sheet from the Compendium of Pesticide Common Names