| Status: | none |
|---|---|
| IUPAC: | (3E,5Z)-tetradeca-3,5-dienoic acid or (Z,E)-tetradeca-3,5-dienoic acid |
| CAS: | (3E,5Z)-3,5-tetradecadienoic acid |
| Reg. No.: | 23400-52-4 |
| Formula: | C14H24O2 |
| Activity: | insect attractants (coleopteran attractants) |
| Notes: | There is no ISO common name for this substance; the name “megatomoic acid” has been used in the literature but has no official status. This substance is named after the insect from which it was isolated, Attagenus megatoma (Fabricius) (Dermestidae, Coloptera). |
| Structure: |  |
| Pronunciation: | měg-a-tō-mō-ǐk ǎs-ǐd Guide to British pronunciation |
| InChI: | InChI=1/C14H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h9-12H,2-8,13H2,1H3,(H,15,16)/b10-9-,12-11+/f/h15H |