| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-1-(2,4-dichlorophenyl)-5-methyl-2-pyrazoline-3,5-dicarboxylic acid |
| CAS: | 1-(2,4-dichlorophenyl)-4,5-dihydro-5-methyl-1H-pyrazole-3,5-dicarboxylic acid |
| Reg. No.: | 135591-00-3 |
| Formula: | C12H10Cl2N2O4 |
| Activity: | herbicide safeners |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example mefenpyr-diethyl [135590-91-9]. |
| Structure: | ![]() |
| Pronunciation: | mě-fěn-pīr Guide to British pronunciation |
| InChIKey: | XEJNEDVTJPXRSM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H10Cl2N2O4/c1-12(11(19)20)5-8(10(17)18)15-16(12)9-3-2-6(13)4-7(9)14/h2-4H,5H2,1H3,(H,17,18)(H,19,20) |
A data sheet from the Compendium of Pesticide Common Names