
French: mécarbinzide (n.m.)Russian: мекарбинзид

Status: ISO 1750 (published)
IUPAC PIN: methyl (1-{[2-(methylsulfanyl)ethyl]carbamoyl}-1H-1,3-benzimidazol-2-yl)carbamate
IUPAC name: methyl (1-{[2-(methylthio)ethyl]carbamoyl}-1H-benzimidazol-2-yl)carbamate
CAS name: methyl N-[1-[[[2-(methylthio)ethyl]amino]carbonyl]-1H-benzimidazol-2-yl]carbamate
CAS Reg. No.: 27386-64-7
Formula: C13H16N4O3S
Activity: fungicides (benzimidazole fungicides; benzimidazolylcarbamate fungicides)
Structure: Structural formula of mecarbinzid
Pronunciation: mě-kar-bǐn-zǐd  Guide to British pronunciation
InChI: InChI=1S/C13H16N4O3S/c1-20-13(19)16-11-15-9-5-3-4-6-10(9)17(11)12(18)14-7-8-21-2/h3-6H,7-8H2,1-2H3,(H,14,18)(H,15,16,19)

A data sheet from the Compendium of Pesticide Common Names