| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | S-ethyl 4-chloro-o-tolyloxythioacetate |
| CAS: | S-ethyl (4-chloro-2-methylphenoxy)ethanethioate |
| Reg. No.: | 25319-90-8 |
| Formula: | C11H13ClO2S |
| Activity: | herbicides (phenoxyacetic herbicides) |
| Notes: | The name “phenothiol” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | ![]() |
| Pronunciation: | ěm sē pē ā thī-ō-ē-thīl Guide to British pronunciation |
| InChI: | InChI=1/C11H13ClO2S/c1-3-15-11(13)7-14-10-5-4-9(12)6-8(10)2/h4-6H,3,7H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names