| Status: | none |
|---|---|
| IUPAC: | (Z)-dodec-7-en-1-yl acetate |
| CAS: | (7Z)-7-dodecen-1-yl acetate |
| Reg. No.: | 14959-86-5 |
| Formula: | C14H26O2 |
| Activity: | insect attractants (straight chain lepidopteran pheromones) |
| Notes: | There is no ISO common name for this substance; the name “looplure” has been used in the literature but it has no official status. This substance is named after the insect from which it was isolated, the cabbage looper Trichoplusia ni (Hübner) (Noctuidae, Lepidoptera). |
| Structure: | ![]() |
| Pronunciation: | loop-lūr Guide to British pronunciation |
| InChIKey: | MUZGQHWTRUVFLG-SREVYHEPSA-N |
| InChI: | InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h6-7H,3-5,8-13H2,1-2H3/b7-6- |
A data sheet from the Compendium of Pesticide Common Names