| Status: | none |
|---|---|
| IUPAC: | mixture of (9Z,11E)-tetradeca-9,11-dien-1-yl acetate and (9Z,12E)-tetradeca-9,12-dien-1-yl acetate or mixture of (E,Z)-tetradeca-9,11-dien-1-yl acetate and (E,Z)-tetradeca-9,12-dien-1-yl acetate |
| CAS: | (9Z,11E)-9,11-tetradecadienyl acetate mixture with (9Z,12E)-9,12-tetradecadienyl acetate |
| Reg. No.: | 60799-74-8 |
| Formula: | C16H28O2 |
| Activity: | insect attractants |
| Notes: | There is no ISO common name for this substance; the name “litlure” has been used in the literature but has no official status. This substance is named after the insect from which it was isolated, Spodoptera litura (Fabricius) (Noctuidae, Lepidoptera). |
| Structure: | ![]() |
| InChI: | (9Z,11E)-9,11-tetradecadienyl acetate InChI=1/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h4-7H,3,8-15H2,1-2H3/b5-4+,7-6- (9Z,12E)-9,12-tetradecadienyl acetate InChI=1/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h3-4,6-7H,5,8-15H2,1-2H3/b4-3+,7-6- |
A data sheet from the Compendium of Pesticide Common Names