| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1α,2α,3β,4α,5α,6β-hexachlorocyclohexane |
| CAS: | (1α,2α,3β,4α,5α,6β)-1,2,3,4,5,6-hexachlorocyclohexane |
| Reg. No.: | 58-89-9 |
| Formula: | C6H6Cl6 |
| Activity: | acaricides (organochlorine acaricides) insecticides (organochlorine insecticides) rodenticides (organochlorine rodenticides) |
| Notes: | lindane is the ISO common name for grades of gamma-HCH containing not less than 99% of the pure compound. |
| Structure: | ![]() |
| InChI: | InChI=1/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3-,4+,5+,6+ |
A data sheet from the Compendium of Pesticide Common Names