| Status: | none |
|---|---|
| IUPAC: | N6-furfuryladenine or N-furfuryl-1H-purin-6-amine |
| CAS: | N-(2-furanylmethyl)-1H-purin-6-amine |
| Reg. No.: | 525-79-1 |
| Formula: | C10H9N5O |
| Activity: | plant growth regulators (cytokinins) |
| Notes: | There is no ISO common name for this substance; the name “kinetin” has been used in the literature but has no official status. |
| Structure: | ![]() |
| InChI: | InChI=1/C10H9N5O/c1-2-7(16-3-1)4-11-9-8-10(13-5-12-8)15-6-14-9/h1-3,5-6H,4H2,(H2,11,12,13,14,15)/f/h11,14H |
A data sheet from the Compendium of Pesticide Common Names