| Status: | China |
|---|---|
| IUPAC: | 2-(dichloromethyl)-2-methyl-1,3-dioxolane |
| CAS: | 2-(dichloromethyl)-2-methyl-1,3-dioxolane |
| Reg. No.: | 22052-63-7 [96420-72-3 has also been used] |
| Formula: | C5H8Cl2O2 |
| Activity: | herbicide safeners |
| Notes: | There is no ISO common name for this substance; the name “jiecaowan” (解草烷) is approved in China. |
| Structure: | ![]() |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | OHXLAOJLJWLEIP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C5H8Cl2O2/c1-5(4(6)7)8-2-3-9-5/h4H,2-3H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names