| Status: |
none |
| IUPAC: |
(1R,2R)-3-oxo-2-(Z)-pent-2-enylcyclopentylacetic acid |
| CAS: |
(1R,2R)-3-oxo-2-(2Z)-2-pentenylcyclopentaneacetic acid |
| Reg. No.: |
6894-38-8 |
| Formula: |
C12H18O3 |
| Activity: |
plant growth regulators (growth inhibitors) |
| Notes: |
There is no ISO common name for this substance; the name “jasmonic acid” has been used in the literature but has no official status. |
| Structure: |
 |
| Pronunciation: |
jǎz-mǒn-ǐk ǎs-ǐd Guide to British pronunciation |
| InChI: |
InChI=1/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10-/m1/s1/f/h14H |