Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-(propan-2-yl)phenyl methylcarbamate |
IUPAC name: | 2-isopropylphenyl methylcarbamate 1979 Rules: o-cumenyl methylcarbamate |
CAS name: | 2-(1-methylethyl)phenyl N-methylcarbamate |
CAS Reg. No.: | 2631-40-5 |
Formula: | C11H15NO2 |
Activity: | insecticides (phenyl carbamate) |
Notes: | The name “MIPC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | ī-sō-prō-karb Guide to British pronunciation |
InChIKey: | QBSJMKIUCUGGNG-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H15NO2/c1-8(2)9-6-4-5-7-10(9)14-11(13)12-3/h4-8H,1-3H3,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names