| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 5-bromo-3-isopropyl-6-methyluracil |
| CAS: | 5-bromo-6-methyl-3-(1-methylethyl)-2,4(1H,3H)-pyrimidinedione |
| Reg. No.: | 314-42-1 |
| Formula: | C8H11BrN2O2 |
| Activity: | herbicides (uracil herbicides) |
| Notes: | * According to ISO 1750, the name “isoprocil” (n.m.) is used in France, but the ISO common name “isocil” (n.m.) also appears to be used. The name “isoprocil” is used in South Africa. |
| Structure: |  |
| Pronunciation: | ī-sō-sǐl Guide to British pronunciation |
| InChIKey: | PSYBGEADHLUXCS-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H11BrN2O2/c1-4(2)11-7(12)6(9)5(3)10-8(11)13/h4H,1-3H3,(H,10,13) |