| Status: | none |
|---|---|
| IUPAC: | (S)-2-methyl-6-methyleneoct-7-en-4-ol |
| CAS: | (4S)-2-methyl-6-methylene-7-octen-4-ol |
| Reg. No.: | 35628-05-8 |
| Formula: | C10H18O |
| Activity: | insect attractants |
| Notes: | There is no ISO common name for this substance; the name “ipsenol” has been used in the literature but has no official status. |
| Structure: | ![]() |
| Pronunciation: | ǐps-ēn-ǒl Guide to British pronunciation |
| InChI: | InChI=1/C10H18O/c1-5-9(4)7-10(11)6-8(2)3/h5,8,10-11H,1,4,6-7H2,2-3H3/t10-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names