| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4-hydroxy-3,5-diiodobenzonitrile or 4-hydroxy-3,5-diiodophenyl cyanide |
| CAS: | 4-hydroxy-3,5-diiodobenzonitrile |
| Reg. No.: | 1689-83-4 |
| Formula: | C7H3I2NO |
| Activity: | herbicides (nitrile herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example ioxynil-lithium [2961-61-7], ioxynil octanoate [3861-47-0], ioxynil-sodium [2961-62-8]. |
| Structure: | ![]() |
| Pronunciation: | ī-ǒks-ǐ-nǐl Guide to British pronunciation |
| InChI: | InChI=1/C7H3I2NO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H |
A data sheet from the Compendium of Pesticide Common Names