| Status: | none |
|---|---|
| IUPAC: | 3-iodoprop-2-ynyl butylcarbamate |
| CAS: | 3-iodo-2-propyn-1-yl N-butylcarbamate |
| Reg. No.: | 55406-53-6 |
| Formula: | C8H12INO2 |
| Activity: | fungicides (carbamate fungicides) |
| Notes: | There is no ISO common name for this substance; the name “iodocarb” has been used in the literature but it has no official status. The name “IPBC” has been used in the literature, but it has no official status. |
| Structure: | ![]() |
| Pronunciation: | ī-ō-dō-karb Guide to British pronunciation |
| InChIKey: | WYVVKGNFXHOCQV-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H12INO2/c1-2-3-6-10-8(11)12-7-4-5-9/h2-3,6-7H2,1H3,(H,10,11) |
A data sheet from the Compendium of Pesticide Common Names