| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1,1′-(iminodioctamethylene)diguanidine or bis(8-guanidinooctyl)amine |
| CAS: | N,N‴-(iminodi-8,1-octanediyl)bis[guanidine] |
| Reg. No.: | 13516-27-3 |
| Formula: | C18H41N7 |
| Activity: | fungicides (aliphatic nitrogen fungicides) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example iminoctadine triacetate [57520-17-9], iminoctadine trialbesilate [169202-06-6]. The ISO common name guazatine was originally given to this substance, but the definition of guazatine was later changed when it became known that the commercial substance was a complex reaction product containing this as well as several other active compounds. |
| Structure: | ![]() |
| Pronunciation: | ǐm-ǐn-ǒk-ta-dēn Guide to British pronunciation |
| InChIKey: | RONFGUROBZGJKP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C18H41N7/c19-17(20)24-15-11-7-3-1-5-9-13-23-14-10-6-2-4-8-12-16-25-18(21)22/h23H,1-16H2,(H4,19,20,24)(H4,21,22,25) |
A data sheet from the Compendium of Pesticide Common Names