| Status: | China |
|---|---|
| IUPAC: | (EZ)-1-(2-chloro-1,3-thiazol-5-ylmethyl)-N-nitroimidazolidin-2-ylideneamine |
| CAS: | 1-[(2-chloro-5-thiazolyl)methyl]-4,5-dihydro-N-nitro-1H-imidazol-2-amine |
| Reg. No.: | 105843-36-5 |
| Formula: | C7H8ClN5O2S |
| Activity: | insecticides (nitroguanidine nicotinoid insecticides; thiazole insecticides) |
| Notes: | There is no ISO common name for this substance; the name “imidaclothiz” (氯噻啉) is approved in China. The IUPAC name and the structural formula correspond to the information in GB 4839-2009 Chinese common names for pesticides. The CAS name and Registry Number are for the tautomer that is preferred under the CAS nomenclature rules. |
| Structure: |  |
| Pronunciation: | ǐm-ǐd-a-klō-thǐz Guide to British pronunciation |
| InChIKey: | OWRSHPAYDYCHSJ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H8ClN5O2S/c8-6-10-3-5(16-6)4-12-2-1-9-7(12)11-13(14)15/h3H,1-2,4H2,(H,9,11) |