| Status: |
ISO 1750 (published) |
| IUPAC: |
(E)-1-(6-chloro-3-pyridylmethyl)-N-nitroimidazolidin-2-ylideneamine |
| CAS: |
(2E)-1-[(6-chloro-3-pyridinyl)methyl]-N-nitro-2-imidazolidinimine |
| Reg. No.: |
138261-41-3 |
| Formula: |
C9H10ClN5O2 |
| Activity: |
insecticides (nitroguanidine insecticides; pyridylmethylamine insecticides) |
| Notes: |
The name “imidacloprid” was originally approved for a mixture of (E)- and (Z)-isomers, but in 2007 the sponsor determined that the substance is comprised almost entirely of the (E)-isomer and requested that the definition be changed. |
| Structure: |
 |
| Pronunciation: |
ǐm-ǐd-a-klō-prǐd Guide to British pronunciation |
| InChI: |
InChI=1/C9H10ClN5O2/c10-8-2-1-7(5-12-8)6-14-4-3-11-9(14)13-15(16)17/h1-2,5H,3-4,6H2,(H,11,13)/f/h11H/b13-9+ |