| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 2-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]-5-methylnicotinic acid |
| CAS: | 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-methyl-3-pyridinecarboxylic acid |
| Reg. No.: | 104098-48-8 |
| Formula: | C14H17N3O3 |
| Activity: | herbicides (imidazolinone herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example imazapic-ammonium [104098-49-9]. |
| Structure: | ![]() |
| Pronunciation: | ǐm-āz-a-pǐk Guide to British pronunciation |
| InChIKey: | PVSGXWMWNRGTKE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H17N3O3/c1-7(2)14(4)13(20)16-11(17-14)10-9(12(18)19)5-8(3)6-15-10/h5-7H,1-4H3,(H,18,19)(H,16,17,20) |
A data sheet from the Compendium of Pesticide Common Names