| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 2-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]-5-methoxymethylnicotinic acid |
| CAS: | 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-(methoxymethyl)-3-pyridinecarboxylic acid |
| Reg. No.: | 114311-32-9 |
| Formula: | C15H19N3O4 |
| Activity: | herbicides (imidazolinone herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example imazamox-ammonium. |
| Structure: | ![]() |
| Pronunciation: | ǐm-āz-a-mǒks Guide to British pronunciation |
| InChIKey: | NUPJIGQFXCQJBK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H19N3O4/c1-8(2)15(3)14(21)17-12(18-15)11-10(13(19)20)5-9(6-16-11)7-22-4/h5-6,8H,7H2,1-4H3,(H,19,20)(H,17,18,21) |
A data sheet from the Compendium of Pesticide Common Names