| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | reaction mixture of 6-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]-m-toluic acid and 2-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]-p-toluic acid |
| CAS: | 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-4(or 5)-methylbenzoic acid |
| Reg. No.: | 100728-84-5 |
| Formula: | C15H18N2O3 |
| Activity: | herbicides (imidazolinone herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example imazamethabenz-methyl [81405-85-8]. The name “咪草酸” is approved in China for imazamethabenz and for imazamethabenz-methyl. |
| Structure: |  |
| Pronunciation: | ǐm-āz-a-měth-a-běnz Guide to British pronunciation |
| InChIKey: | 4-methyl isomer: KFEFNHNXZQYTEW-UHFFFAOYSA-N 5-methyl isomer: LUZQQSLTOCTPIN-UHFFFAOYSA-N identifier for mixture (not valid): LWMLXPWIAUSXBM-UHFFFAOYSA-N |
| InChI: | 4-methyl isomer: InChI=1S/C15H18N2O3/c1-8(2)15(4)14(20)16-12(17-15)11-7-9(3)5-6-10(11)13(18)19/h5-8H,1-4H3,(H,18,19)(H,16,17,20) 5-methyl isomer: InChI=1S/C15H18N2O3/c1-8(2)15(4)14(20)16-12(17-15)10-6-5-9(3)7-11(10)13(18)19/h5-8H,1-4H3,(H,18,19)(H,16,17,20) |