| Status: | WHO INN |
|---|---|
| IUPAC: | (RS)-sec-butyl (RS)-2-(2-hydroxyethyl)piperidine-1-carboxylate |
| CAS: | 1-methylpropyl 2-(2-hydroxyethyl)-1-piperidinecarboxylate |
| Reg. No.: | 119515-38-7 |
| Formula: | C12H23NO3 |
| Activity: | insect repellents |
| Notes: | There is no ISO common name for this substance; the name “icaridin” is approved by the World Health Organization. The name “picaridin” has been used in the literature but has no official status. |
| Structure: |  |
| InChI: | sp3 tetrahedral stereochemistry not specified InChI=1/C12H23NO3/c1-3-10(2)16-12(15)13-8-5-4-6-11(13)7-9-14/h10-11,14H,3-9H2,1-2H3 all combinations of (R)- and (S)-stereoisomers InChI=1/C12H23NO3/c1-3-10(2)16-12(15)13-8-5-4-6-11(13)7-9-14/h10-11,14H,3-9H2,1-2H3/t10?,11? |