| Status: | none |
|---|---|
| IUPAC: | indol-3-ylacetic acid or β-indoleacetic acid |
| CAS: | 1H-indole-3-acetic acid |
| Reg. No.: | 87-51-4 |
| Formula: | C10H9NO2 |
| Activity: | plant growth regulators (auxins) |
| Notes: | There is no ISO common name for this substance; the name “IAA” has been used in the literature but has no official status. |
| Structure: | ![]() |
| Pronunciation: | ī ā ā Guide to British pronunciation |
| InChI: | InChI=1/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/f/h12H |
A data sheet from the Compendium of Pesticide Common Names