| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 5-methylisoxazol-3-ol or 5-methyl-1,2-oxazol-3-ol |
| CAS: | 5-methyl-3(2H)-isoxazolone |
| Reg. No.: | 10004-44-1 |
| Formula: | C4H5NO2 |
| Activity: | fungicides (oxazole fungicides) plant growth regulators (growth stimulators) |
| Notes: | The IUPAC name and the structural formula correspond to the information provided by the manufacturer. The CAS name and Registry Number are for the tautomer that is preferred under the CAS nomenclature rules. The name “hydroxyisoxazole” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |  |
| Pronunciation: | hī-měks-a-zǒl Guide to British pronunciation |
| InChI: | InChI=1/C4H5NO2/c1-3-2-4(6)5-7-3/h2H,1H3,(H,5,6)/f/h6H CAS-preferred tautomer: InChI=1/C4H5NO2/c1-3-2-4(6)5-7-3/h2H,1H3,(H,5,6)/f/h5H |