Status: | China |
---|---|
IUPAC PIN: | (6H,12H-dibenzo[d,g][1,3]dioxocin-6-yl){[(propan-2-ylidene)amino]oxy}methanone |
IUPAC name: | acetone O-(12H-dibenzo[d,g][1,3]dioxocin-6-ylcarbonyl)oxime |
CAS name: | 2-propanone O-(12H-dibenzo[d,g][1,3]dioxocin-6-ylcarbonyl)oxime |
CAS Reg. No.: | |
Formula: | C18H17NO4 |
Activity: | herbicides (unclassified) |
Notes: | There is no ISO common name for this substance; the name “huancaiwo” (环草肟) is approved in China. |
Structure: | |
Pronunciation: | Guide to British pronunciation |
InChIKey: | ZXPDMFFPTPNTQZ-UHFFFAOYSA-N |
InChI: | InChI=1S/C18H17NO4/c1-12(2)19-23-17(20)18-21-15-9-5-3-7-13(15)11-14-8-4-6-10-16(14)22-18/h3-10,18H,11H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names