| Status: | USSR |
|---|---|
| IUPAC PIN: | azepan-1-yl(phenyl)methanone |
| IUPAC name: | azepan-1-yl phenyl ketone 1979 Rules: perhydroazepin-1-yl phenyl ketone |
| CAS name: | (hexahydro-1H-azepin-1-yl)phenylmethanone |
| CAS Reg. No.: | 3653-39-2 |
| Formula: | C13H17NO |
| Activity: | insect repellents |
| Notes: | There is no ISO common name for this substance; the name “hexamide” (гексамид) was used in the former USSR; the name “benzimine” (бензимин) was also used. |
| Structure: |  |
| Pronunciation: | hěks-a-mīd Guide to British pronunciation |
| InChIKey: | KZLCCMBSJDXNDG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H17NO/c15-13(12-8-4-3-5-9-12)14-10-6-1-2-7-11-14/h3-5,8-9H,1-2,6-7,10-11H2 |