| Status: | USSR |
|---|---|
| IUPAC: | perhydroazepin-1-yl phenyl ketone or azepan-1-yl phenyl ketone |
| CAS: | 1-benzoylhexahydro-1H-azepine |
| Reg. No.: | 3653-39-2 |
| Formula: | C13H17NO |
| Activity: | insect repellents |
| Notes: | There is no ISO common name for this substance; the name “hexamide” (гексамид) was used in the former USSR; the name “benzimine” (бензимин) was also used. |
| Structure: | ![]() |
| Pronunciation: | hěks-a-mīd Guide to British pronunciation |
| InChI: | InChI=1/C13H17NO/c15-13(12-8-4-3-5-9-12)14-10-6-1-2-7-11-14/h3-5,8-9H,1-2,6-7,10-11H2 |
A data sheet from the Compendium of Pesticide Common Names