| Status: | ISO 765 |
|---|---|
| IUPAC: | hexachlorobenzene or perchlorobenzene |
| CAS: | hexachlorobenzene |
| Reg. No.: | 118-74-1 |
| Formula: | C6Cl6 |
| Activity: | fungicides (aromatic fungicides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | ![]() |
| Pronunciation: | hěks-a-klor-ō-běn-zēn Guide to British pronunciation |
| InChI: | InChI=1/C6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
A data sheet from the Compendium of Pesticide Common Names