| Status: | ESA |
|---|---|
| IUPAC: | N2,N2,N4,N4,N6,N6-hexamethyl-1,3,5-triazine-2,4,6-triamine |
| CAS: | N,N,N′,N′,N″,N″-hexamethyl-1,3,5-triazine-2,4,6-triamine |
| Reg. No.: | 645-05-6 |
| Formula: | C9H18N6 |
| Activity: | chemosterilants |
| Notes: | There is no ISO common name for this substance; the name “hemel” is approved by the Entomological Society of America and the name “altretamine” is approved by the World Health Organization. |
| Structure: | ![]() |
| InChI: | InChI=1/C9H18N6/c1-13(2)7-10-8(14(3)4)12-9(11-7)15(5)6/h1-6H3 |
A data sheet from the Compendium of Pesticide Common Names