| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1,2,3,4,5,6-hexachlorocyclohexane |
| CAS: | 1,2,3,4,5,6-hexachlorocyclohexane |
| Reg. No.: | 608-73-1 |
| Formula: | C6H6Cl6 |
| Activity: | insecticides (organochlorine insecticides) rodenticides (organochlorine rodenticides) |
| Notes: | The common name “BHC” is also approved by ISO. The name “benzene hexachloride” is used in the USA; the name “hexachlor” is used in Sweden; the name “hexachloran” (гексахлоран) was used in the former USSR. The ISO common name for the gamma-isomer is gamma-HCH. |
| Structure: |  |
| InChI: | InChI=1/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H |