| Status: | ESA |
|---|---|
| IUPAC: | mixture of cis-trans-3,3-dimethyl-Δ1,α-cyclohexaneacetaldehyde, cis-3,3-dimethyl-Δ1,β-cyclohexaneethanol and (1R,2S)-2-isopropenyl-1-methylcyclobutaneethanol or mixture of (EZ)-(3,3-dimethylcyclohexylidene)acetaldehyde, (Z)-2-(3,3-dimethylcyclohexylidene)ethanol and 2-[(1R,2S)-2-isopropenyl-1-methylcyclobutyl]ethanol |
| CAS: | (3,3-dimethylcyclohexylidene)acetaldehyde mixture with (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol and (1R,2S)-1-methyl-2-(1-methylethenyl)cyclobutaneethanol |
| Reg. No.: | 11104-05-5 |
| Formula: | C10H16O + C10H18O + C10H18O |
| Activity: | insect attractants (coleopteran attractants) mating disrupters |
| Notes: | There is no ISO common name for this substance; the name “grandlure” is approved by the Entomological Society of America. This substance is named after the insect from which it was isolated, Anthonomus grandis Boheman (Curculionidae, Coleoptera). |
| Structure: | ![]() |
| Pronunciation: | grǎnd-lūr Guide to British pronunciation |
| InChI: | (3,3-dimethylcyclohexylidene)acetaldehyde: InChI=1/C10H16O/c1-10(2)6-3-4-9(8-10)5-7-11/h5,7H,3-4,6,8H2,1-2H3 (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol: InChI=1/C10H18O/c1-10(2)6-3-4-9(8-10)5-7-11/h5,11H,3-4,6-8H2,1-2H3/b9-5- (1R,2S)-1-methyl-2-(1-methylethenyl)cyclobutaneethanol: InChI=1/C10H18O/c1-8(2)9-4-5-10(9,3)6-7-11/h9,11H,1,4-7H2,2-3H3/t9-,10+/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names