| Status: | none |
|---|---|
| IUPAC: | 1:1 mixture of (7Z,11E)- and (7Z,11Z)-hexadeca-7,11-dien-1-yl acetate or 1:1 mixture of (Z,E)- and (Z,Z)-hexadeca-7,11-dien-1-yl acetate |
| CAS: | (7Z)-7,11-hexadecadienyl acetate |
| Reg. No.: | 50933-33-0 |
| Formula: | C18H32O2 |
| Activity: | insect attractants mating disrupters |
| Notes: | There is no ISO common name for this substance; the name “gossyplure” has been used in the literature but has no official status. This substance is named after the insect from which it was isolated, Pectinophora gossypiella (Saunders) (Gelechiidae, Lepidoptera). |
| Structure: |  |
| InChI: | InChI=1/C18H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h6-7,10-11H,3-5,8-9,12-17H2,1-2H3/b7-6?,11-10- |