Status: | China |
---|---|
IUPAC PIN: | 6-[(difluoromethyl)sulfanyl]-N2,N4-di(propan-2-yl)-1,3,5-triazine-2,4-diamine |
IUPAC name: | 6-[(difluoromethyl)thio]-N2,N4-diisopropyl-1,3,5-triazine-2,4-diamine |
CAS name: | 6-[(difluoromethyl)thio]-N2,N4-bis(1-methylethyl)-1,3,5-triazine-2,4-diamine |
CAS Reg. No.: | 103427-73-2 |
Formula: | C10H17F2N5S |
Activity: | herbicides (alkylthiotriazine) |
Notes: | There is no ISO common name for this substance; the name “fucaojing” (氟草净) is approved in China. |
Structure: | |
Pronunciation: | Guide to British pronunciation |
InChIKey: | NWUJLIRYNYNDAJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H17F2N5S/c1-5(2)13-8-15-9(14-6(3)4)17-10(16-8)18-7(11)12/h5-7H,1-4H3,(H2,13,14,15,16,17) |
A data sheet from the Compendium of Pesticide Common Names