| Approval: | ISO |
|---|---|
| IUPAC PIN: | ethyl hydrogen phosphonate |
| IUPAC name: | ethyl hydrogen phosphonate |
| CAS name: | ethyl hydrogen phosphonate |
| CAS Reg. No.: | 15845-66-6 |
| Formula: | C2H7O3P |
| Activity: | fungicides (phosphonate) plant activators |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example fosetyl-aluminium [39148-24-8] (this would be called fosetyl-aluminum in the USA). The name “phosethyl” has been used in the literature, but it has no official status. |
| Structure: |  |
| Pronunciation: | fǒs-ē-tīl Guide to British pronunciation |
| InChIKey: | VUERQRKTYBIULR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C2H7O3P/c1-2-5-6(3)4/h6H,2H2,1H3,(H,3,4) |