| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4-[(EZ)-dimethylaminomethyleneamino]-m-tolyl methylcarbamate |
| CAS: | N,N-dimethyl-N′-[2-methyl-4-[[(methylamino)carbonyl]oxy]phenyl]methanimidamide |
| Reg. No.: | 17702-57-7 |
| Formula: | C12H17N3O2 |
| Activity: | acaricides (formamidine acaricides) insecticides (formamidine insecticides) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example formparanate hydrochloride [35452-92-7]. |
| Structure: | ![]() |
| Pronunciation: | form-pǎr-a-nāt Guide to British pronunciation |
| InChI: | InChI=1/C12H17N3O2/c1-9-7-10(17-12(16)13-2)5-6-11(9)14-8-15(3)4/h5-8H,1-4H3,(H,13,16)/f/h13H |
A data sheet from the Compendium of Pesticide Common Names