| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 3-[(EZ)-dimethylaminomethyleneamino]phenyl methylcarbamate |
| CAS: | N,N-dimethyl-N′-[3-[[(methylamino)carbonyl]oxy]phenyl]methanimidamide |
| Reg. No.: | 22259-30-9 |
| Formula: | C11H15N3O2 |
| Activity: | acaricides (formamidine acaricides) insecticides (formamidine insecticides) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example formetanate hydrochloride [23422-53-9]. |
| Structure: | ![]() |
| Pronunciation: | for-mět-a-nāt Guide to British pronunciation |
| InChI: | InChI=1/C11H15N3O2/c1-12-11(15)16-10-6-4-5-9(7-10)13-8-14(2)3/h4-8H,1-3H3,(H,12,15)/f/h12H |
A data sheet from the Compendium of Pesticide Common Names