| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 9-hydroxyfluorene-9-carboxylic acid |
| CAS: | 9-hydroxy-9H-fluorene-9-carboxylic acid |
| Reg. No.: | 467-69-6 |
| Formula: | C14H10O3 |
| Activity: | plant growth regulators (morphactins) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example flurenol-butyl [2314-09-2], flurenol-methyl [1216-44-0]. The name “flurecol” is used in Canada, Denmark and the USA, and was formerly approved by the British Standards Institution. |
| Structure: | ![]() |
| Pronunciation: | flūr-ē-nǒl Guide to British pronunciation |
| InChI: | InChI=1/C14H10O3/c15-13(16)14(17)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8,17H,(H,15,16)/f/h15H |
A data sheet from the Compendium of Pesticide Common Names