Status: | JMAFF |
---|---|
IUPAC PIN: | 3,4-dichloro-1-(4-fluorophenyl)-1H-pyrrole-2,5-dione |
IUPAC name: | 3,4-dichloro-1-(4-fluorophenyl)-1H-pyrrole-2,5-dione 1979 Rules: 2,3-dichloro-N-(4-fluorophenyl)maleimide |
CAS name: | 3,4-dichloro-1-(4-fluorophenyl)-1H-pyrrole-2,5-dione |
CAS Reg. No.: | 41205-21-4 |
Formula: | C10H4Cl2FNO2 |
Activity: | fungicides (maleimide) |
Notes: | There is no ISO common name for this substance; the name “fluoroimide” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. The spelling “fluoromide” has also been used. |
Structure: | |
Pronunciation: | floo-ō-rō-ǐm-īd Guide to British pronunciation |
InChIKey: | IPENDKRRWFURRE-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H4Cl2FNO2/c11-7-8(12)10(16)14(9(7)15)6-3-1-5(13)2-4-6/h1-4H |
A data sheet from the Compendium of Pesticide Common Names