fluoroacetic acid

French: acide fluoroacétique (n.m.)Russian: фторуксусная кислота


Status: ISO 765
PIN: fluoroacetic acid
IUPAC: fluoroacetic acid
CAS: 2-fluoroacetic acid
Reg. No.: 144-49-0
Formula: C2H3FO2
Activity: rodenticides (organofluorine rodenticides)
Notes: This substance is considered by the International Organization for Standardization not to require a common name.
The sodium salt, sodium fluoroacetate [62-74-8], is also considered not to require a common name.
Structure: Structural formula of fluoroacetic acid
Pronunciation: floo-a-rō-a--tǐk ǎs-ǐd  Guide to British pronunciation
InChIKey: QEWYKACRFQMRMB-UHFFFAOYSA-N
InChI: InChI=1S/C2H3FO2/c3-1-2(4)5/h1H2,(H,4,5)

A data sheet from the Compendium of Pesticide Common Names